Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name |
GPCRdb ID |
Reference ligand |
Vendors |
Species |
Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source |
Mol weight |
Rot Bonds |
H don |
H acc |
LogP |
Smiles |
DOI |
|
| 12948 | 1021 | None | 0 | Human | Functional | pIC50 | = | 8 | 8.0 | - | 1 | Guide to Pharmacology | 524 | 12 | 1 | 10 | 2.7 | CCOC1=CC(C)=NC(=N1)N(CCOC)S(=O)(=O)C2=CC=C(NCC3=C(F)C=NC=C3F)N=C2OC | 37741852 | |||
| 168510218 | 1021 | None | 0 | Human | Functional | pIC50 | = | 8 | 8.0 | - | 1 | Guide to Pharmacology | 524 | 12 | 1 | 10 | 2.7 | CCOC1=CC(C)=NC(=N1)N(CCOC)S(=O)(=O)C2=CC=C(NCC3=C(F)C=NC=C3F)N=C2OC | 37741852 | |||
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name |
GPCRdb ID |
Reference ligand |
Vendors |
Species |
Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source |
Mol weight |
Rot Bonds |
H don |
H acc |
LogP |
Smiles |
DOI |
|